(1S,2R,4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicene-4a-carboxylic acid structure
|
Common Name | (1S,2R,4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicene-4a-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 35959-01-4 | Molecular Weight | 512.72 | |
| Density | 1.13g/cm3 | Boiling Point | 601.1ºC at 760 mmHg | |
| Molecular Formula | C32H48O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7ºC | |
Use of (1S,2R,4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicene-4a-carboxylic acid3-Acetyl-11-keto-ursolic acid (Compound 18) is a triterpenoid compound derived from Eriobotrya japonicaleaves. 3-Acetyl-11-keto-ursolic acid has 11B-hydroxysteroid dehydrogenase 1 (11b-HSD1) inhibitory activity. 3-Acetyl-11-keto-ursolic acid can be used for anti-diabetes research[1]. |
| Name | 1,4-dichloro-2-fluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Acetyl-11-keto-ursolic acid (Compound 18) is a triterpenoid compound derived from Eriobotrya japonicaleaves. 3-Acetyl-11-keto-ursolic acid has 11B-hydroxysteroid dehydrogenase 1 (11b-HSD1) inhibitory activity. 3-Acetyl-11-keto-ursolic acid can be used for anti-diabetes research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 601.1ºC at 760 mmHg |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.72 |
| Flash Point | 184.7ºC |
| Exact Mass | 512.35000 |
| PSA | 80.67000 |
| LogP | 6.83930 |
| Index of Refraction | 1.549 |
| InChIKey | XDHCWTUZCOFKRH-CIKBGXLUSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2C(=O)C=C2C4C(C)C(C)CCC4(C(=O)O)CCC23C)C1(C)C |
| 3-acetyl-11-keto-ursolic acid |
| 3-O-Acetyl-1,2-O-isopropylidene-|A-D-glucofuranose |
| 11-oxo-3O-acetylursolic acid |
| 11-oxo-ursolic acid acetate |
| 3-O-acetyl-11-oxoursolic acid |
| 11-oxo acetyl ursolic acid |