3-Quinolinecarboxylicacid,4-amino-6-methyl-(9CI)
Modify Date: 2024-01-30 04:25:06
3-Quinolinecarboxylicacid,4-amino-6-methyl-(9CI) structure
|
Common Name | 3-Quinolinecarboxylicacid,4-amino-6-methyl-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 359427-49-9 | Molecular Weight | 202.20900 | |
| Density | 1.368g/cm3 | Boiling Point | 419.042ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.23ºC | |
| Name | 4-amino-6-methylquinoline-3-carboxylic acid |
|---|
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 419.042ºC at 760 mmHg |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Flash Point | 207.23ºC |
| Exact Mass | 202.07400 |
| PSA | 76.94000 |
| LogP | 1.75370 |
| Index of Refraction | 1.716 |
| InChIKey | YALLSKGHTVYOOB-UHFFFAOYSA-N |
| SMILES | Cc1ccc2ncc(C(=O)O)c(N)c2c1 |
| HS Code | 2933499090 |
|---|
|
~96%
3-Quinolinecarb... CAS#:359427-49-9 |
| Literature: Stanczak; Pakulska; Pietrzak; Lewgowd Pharmazie, 2001 , vol. 56, # 6 p. 501 - 505 |
|
~%
3-Quinolinecarb... CAS#:359427-49-9 |
| Literature: Stanczak; Pakulska; Pietrzak; Lewgowd Pharmazie, 2001 , vol. 56, # 6 p. 501 - 505 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |