2,6-dibromo-4-(trifluoromethyl)phenol
Modify Date: 2025-10-05 14:08:18
2,6-dibromo-4-(trifluoromethyl)phenol structure
|
Common Name | 2,6-dibromo-4-(trifluoromethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 35852-57-4 | Molecular Weight | 319.90100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Br2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dibromo-4-(trifluoromethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H3Br2F3O |
|---|---|
| Molecular Weight | 319.90100 |
| Exact Mass | 317.85000 |
| PSA | 20.23000 |
| LogP | 3.93600 |
| InChIKey | IEMNQLAXBXXIKT-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)cc(C(F)(F)F)cc1Br |
| HS Code | 2908199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:3337-62-0| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,6-dibromo-4-trifluoromethyl-phenol |
| 2,6-Dibrom-4-trifluormethyl-phenol |
| 3.5-Dibrom-4-hydroxy-1-trifluormethyl-benzol |
| α.α.α-Trifluor-3.5-dibrom-4-hydroxy-toluol |