Denaverine structure
|
Common Name | Denaverine | ||
|---|---|---|---|---|
| CAS Number | 3579-62-2 | Molecular Weight | 383.52400 | |
| Density | 1.04g/cm3 | Boiling Point | 489.9ºC at 760mmHg | |
| Molecular Formula | C24H33NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.1ºC | |
| Name | 2-(dimethylamino)ethyl 2-(2-ethylbutoxy)-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 489.9ºC at 760mmHg |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.52400 |
| Flash Point | 250.1ºC |
| Exact Mass | 383.24600 |
| PSA | 38.77000 |
| LogP | 4.48780 |
| Index of Refraction | 1.526 |
| InChIKey | FPTOUQZVCUIPHY-UHFFFAOYSA-N |
| SMILES | CCC(CC)COC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Denaverinum |
| Denaverinum [INN-Latin] |
| denaverine[inn] |
| Denaverine |
| Denaverina [INN-Spanish] |
| Denaverina |