2-Imidazolidinone,1-[2-(2,4-dichlorophenoxy)acetyl]- structure
|
Common Name | 2-Imidazolidinone,1-[2-(2,4-dichlorophenoxy)acetyl]- | ||
|---|---|---|---|---|
| CAS Number | 35767-81-8 | Molecular Weight | 289.11500 | |
| Density | 1.476g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(2,4-dichlorophenoxy)acetyl]imidazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.476g/cm3 |
|---|---|
| Molecular Formula | C11H10Cl2N2O3 |
| Molecular Weight | 289.11500 |
| Exact Mass | 288.00700 |
| PSA | 58.64000 |
| LogP | 2.19070 |
| Index of Refraction | 1.59 |
| InChIKey | OUNXZJRZRWIRKS-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCNC1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[(2,4-dichloro-phenoxy)-acetyl]-imidazolidin-2-one |
| HMS3056C11 |
| 1-(2,4-Dichlorphenoxyacetyl)-2-imidazolidinon |