2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylsulfanylphenyl)methyl]acetamide
Modify Date: 2025-09-12 14:08:00
![2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylsulfanylphenyl)methyl]acetamide Structure](https://image.chemsrc.com/caspic/240/3576-65-6.png)
2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylsulfanylphenyl)methyl]acetamide structure
|
Common Name | 2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylsulfanylphenyl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 3576-65-6 | Molecular Weight | 308.22400 | |
| Density | 1.35g/cm3 | Boiling Point | 460.3ºC at 760 mmHg | |
| Molecular Formula | C12H15Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.2ºC | |
| Name | 2,2-dichloro-N-(2-hydroxyethyl)-N-[(4-methylsulfanylphenyl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 460.3ºC at 760 mmHg |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.22400 |
| Flash Point | 232.2ºC |
| Exact Mass | 307.02000 |
| PSA | 65.84000 |
| LogP | 2.53310 |
| Index of Refraction | 1.6 |
| InChIKey | HVMXIEQXUSVJTC-UHFFFAOYSA-N |
| SMILES | CSc1ccc(CN(CCO)C(=O)C(Cl)Cl)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
2,2-dichloro-N-... CAS#:3576-65-6 |
| Literature: Kidd,D.A.A.; Wright,D.E. Journal of the Chemical Society, 1962 , p. 1420 - 1427 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| m &b 5371 |
| ls-8874 |