2,3,4,5-tetrabromo-6-hydroxybenzoic acid
Modify Date: 2025-09-24 17:00:02
2,3,4,5-tetrabromo-6-hydroxybenzoic acid structure
|
Common Name | 2,3,4,5-tetrabromo-6-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35754-69-9 | Molecular Weight | 453.70500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2Br4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,5-tetrabromo-6-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H2Br4O3 |
|---|---|
| Molecular Weight | 453.70500 |
| Exact Mass | 449.67400 |
| PSA | 57.53000 |
| LogP | 4.14040 |
| InChIKey | USHRBRKMUOGABS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(O)c(Br)c(Br)c(Br)c1Br |
|
~92%
2,3,4,5-tetrabr... CAS#:35754-69-9 |
| Literature: Renneberg, Bernd; Kellner, Michael; Laatsch, Hartmut Liebigs Annalen der Chemie, 1993 , # 8 p. 847 - 852 |
|
~%
2,3,4,5-tetrabr... CAS#:35754-69-9 |
| Literature: Farinholt; Stuart; Twiss Journal of the American Chemical Society, 1940 , vol. 62, p. 1237,1240 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:608-71-9| 3,4,5,6-tetrabromo-2-hydroxybenzoic acid |
| 2,3,4,5-tetrabromo-6-hydroxy-benzoic acid |
| Benzoic acid,2,3,4,5-tetrabromo-6-hydroxy |
| 2,3,4,5-Tetrabrom-6-hydroxy-benzoesaeure |
| 3,4,5,6-Tetrabrom-2-hydroxybenzoesaeure |