3-Chloro-4-phenoxyaniline hydrochloride structure
|
Common Name | 3-Chloro-4-phenoxyaniline hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 35734-64-6 | Molecular Weight | 256.128 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-4-phenoxyaniline,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11Cl2NO |
|---|---|
| Molecular Weight | 256.128 |
| Exact Mass | 255.021774 |
| PSA | 35.25000 |
| LogP | 5.09770 |
| InChIKey | SLYYYJKEHVBMBK-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ccc(Oc2ccccc2)c(Cl)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Chlor-4-phenoxy-anilin,Hydrochlorid |
| 3-chloro-4-phenoxy-aniline,hydrochloride |
| 3-Chloro-4-phenoxyaniline hydrochloride (1:1) |
| Benzenamine, 3-chloro-4-phenoxy-, hydrochloride (1:1) |
| 3-Chloro-4-phenoxyaniline hydrochloride |