9-[2-(Butoxycarbonyl)phenyl]-6-(diethylamino)-N,N-diethyl-3H-xant hen-3-iminium chloride structure
|
Common Name | 9-[2-(Butoxycarbonyl)phenyl]-6-(diethylamino)-N,N-diethyl-3H-xant hen-3-iminium chloride | ||
|---|---|---|---|---|
| CAS Number | 3571-37-7 | Molecular Weight | 535.11700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H39ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-[2-(Butoxycarbonyl)phenyl]-6-(diethylamino)-N,N-diethyl-3H-xant hen-3-iminium chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H39ClN2O3 |
|---|---|
| Molecular Weight | 535.11700 |
| Exact Mass | 534.26500 |
| PSA | 45.92000 |
| LogP | 5.18740 |
| InChIKey | RZODCBGJJQHDBD-UHFFFAOYSA-M |
| SMILES | CCCCOC(=O)c1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2cc(N(CC)CC)ccc12.[Cl-] |
| HS Code | 2922199090 |
|---|
|
~%
9-[2-(Butoxycar... CAS#:3571-37-7 |
| Literature: Ramos; Vilhena; Santos; Almeida Magnetic Resonance in Chemistry, 2000 , vol. 38, # 6 p. 475 - 478 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butylmercuric chloride |
| MERCURY,BUTYLCHLORO |
| Butylmercury chloride |
| Butylmerkurichlorid [Czech] |
| 9-(2-butoxycarbonyl-phenyl)-3,6-bis-diethylamino-xanthylium,chloride |
| Butylquecksilberchlorid |
| 2'-(6-diethylamino-3-diethylimino-3H-xanthen-9-yl)benzoic acid n-butyl ester chloride |
| Butyl-quecksilber(II)-chlorid |
| n-Butylquecksilberchlorid |
| rhodamine B n-butyl ester hydrochloride |
| 9-(2-Butoxycarbonyl-phenyl)-3,6-bis-diaethylamino-xanthylium,Chlorid |
| Butylchloromercury |
| n-Butylmercuric chloride |
| Butylmercurichlorid |
| butyl rhodamine B |
| rhodamine B n-butyl ester chloride |
| n-Butyl mercury chloride |