ethyl 4-(1,2,2-trifluoroethenoxy)benzoate structure
|
Common Name | ethyl 4-(1,2,2-trifluoroethenoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 35703-78-7 | Molecular Weight | 246.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(1,2,2-trifluoroethenoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9F3O3 |
|---|---|
| Molecular Weight | 246.18300 |
| Exact Mass | 246.05000 |
| PSA | 35.53000 |
| LogP | 3.27720 |
| InChIKey | LOQCNQHGIOJAFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OC(F)=C(F)F)cc1 |
|
~%
ethyl 4-(1,2,2-... CAS#:35703-78-7 |
| Literature: Spraul, Bryan K.; Suresh; Jin, Jianyong; Smith Jr., Dennis W. Journal of the American Chemical Society, 2006 , vol. 128, # 21 p. 7055 - 7064 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| p-Ethoxycarbonyl-phenyl-trifluorvinyl-ether |
| p-Ethoxycarbonylphenyl-1,1,2-trifluorvinylether |