1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid
Modify Date: 2025-08-26 12:08:33
1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid structure
|
Common Name | 1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 357-31-3 | Molecular Weight | 232.10200 | |
| Density | 1.789g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C3H2F6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.789g/cm3 |
|---|---|
| Molecular Formula | C3H2F6O3S |
| Molecular Weight | 232.10200 |
| Exact Mass | 231.96300 |
| PSA | 62.75000 |
| LogP | 2.44820 |
| Index of Refraction | 1.337 |
| InChIKey | DMOBTBZPQXBGRE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)C(F)(F)C(F)C(F)(F)F |
|
~91%
1,1,2,3,3,3-hex... CAS#:357-31-3 |
| Literature: Harmer, Mark Andrew; Junk, Christopher P.; Vickery, Jemma; Schnepp, Zoe Patent: US2007/100193 A1, 2007 ; Location in patent: Page/Page column 5 ; |
|
~%
1,1,2,3,3,3-hex... CAS#:357-31-3 |
| Literature: Koshar et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4595 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1,2,3,3,3-Hexafluor-propan-1-sulfonsaeure |
| 1,1,2,3,3,3-hexafluoro-propane-1-sulfonic acid |
| 1-Propanesulfonic acid,1,1,2,3,3,3-hexafluoro |
| CF3CHFCF2SO2OH |
| 1,1,2,3,3,3-hexafluoropropanesulfonic acid |
| 3,3,3,2,1,1-hexafluoropropane sulfonic acid |
| 1,1,2,3,3,3-hexafluoro-1-propanesulfonic acid |