2(1H)-Quinazolinethione,4-(phenylamino)-
Modify Date: 2025-08-26 11:21:31
2(1H)-Quinazolinethione,4-(phenylamino)- structure
|
Common Name | 2(1H)-Quinazolinethione,4-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 35696-83-4 | Molecular Weight | 253.32200 | |
| Density | 1.29g/cm3 | Boiling Point | 419.7ºC at 760mmHg | |
| Molecular Formula | C14H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | 4-anilino-1H-quinazoline-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760mmHg |
| Molecular Formula | C14H11N3S |
| Molecular Weight | 253.32200 |
| Flash Point | 207.6ºC |
| Exact Mass | 253.06700 |
| PSA | 72.80000 |
| LogP | 4.10900 |
| Index of Refraction | 1.705 |
| InChIKey | ADLSBRLSQMUINQ-UHFFFAOYSA-N |
| SMILES | S=c1nc(Nc2ccccc2)c2ccccc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~78%
2(1H)-Quinazoli... CAS#:35696-83-4 |
| Literature: Atanassov, Plamen K.; Linden, Anthony; Heimgartner, Heinz Helvetica Chimica Acta, 2004 , vol. 87, # 7 p. 1873 - 1887 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:34923-95-0| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Thio-4-anilino-1,2-dihydro-chinazolin |
| HMS1715F16 |