2,2',3,4,4',5-PCB structure
|
Common Name | 2,2',3,4,4',5-PCB | ||
|---|---|---|---|---|
| CAS Number | 35694-06-5 | Molecular Weight | 360.878 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 399.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H4Cl6 | Melting Point | 78°C | |
| MSDS | N/A | Flash Point | 195.3±23.9 °C | |
| Name | 1,2,3,4-tetrachloro-5-(2,4-dichlorophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.1±37.0 °C at 760 mmHg |
| Melting Point | 78°C |
| Molecular Formula | C12H4Cl6 |
| Molecular Weight | 360.878 |
| Flash Point | 195.3±23.9 °C |
| Exact Mass | 357.844421 |
| LogP | 6.79 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | CKLLRBPBZLTGDJ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2cc(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1 |
| RIDADR | UN 2315 |
|---|---|
| Packaging Group | II |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2',3,4,4',5-pentachlorobiphenyl |
| 2,2',3,4,4',5-Hexachlorobiphenyl |
| 2,2',3,4,4',5-PCB |
| 1,1'-Biphenyl,2,2',3,4,4',5-hexachloro |
| PCB 137 |
| 1,1'-Biphenyl, 2,2',3,4,4',5-hexachloro- |