benzo[1,3]dioxol-5-yl-(1H-pyrrol-2-yl)methanone structure
|
Common Name | benzo[1,3]dioxol-5-yl-(1H-pyrrol-2-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 35667-12-0 | Molecular Weight | 215.20500 | |
| Density | 1.37g/cm3 | Boiling Point | 390.4ºC at 760 mmHg | |
| Molecular Formula | C12H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.9ºC | |
| Name | 1,3-benzodioxol-5-yl(1H-pyrrol-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 390.4ºC at 760 mmHg |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20500 |
| Flash Point | 189.9ºC |
| Exact Mass | 215.05800 |
| PSA | 51.32000 |
| LogP | 1.97440 |
| Index of Refraction | 1.64 |
| InChIKey | YGDPVRWIDZITIB-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc2c(c1)OCO2)c1ccc[nH]1 |
| HS Code | 2934999090 |
|---|
|
~%
benzo[1,3]dioxo... CAS#:35667-12-0 |
| Literature: Sumitomo Pharmaceuticals Company, Limited Patent: EP1479384 A1, 2004 ; |
|
~%
benzo[1,3]dioxo... CAS#:35667-12-0 |
| Literature: Dolby,L.J. et al. Journal of Organic Chemistry, 1972 , vol. 37, p. 3691 - 3695 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3,4-Methylendioxybenzoyl)pyrrol |
| BENZO[1,3]DIOXOL-5-YL-(1H-PYRROL-2-YL)METHANONE |
| benzo[1,3]dioxol-5-yl-pyrrol-2-yl-methanone |