3-naphthalen-1-yl-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione structure
|
Common Name | 3-naphthalen-1-yl-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 35629-65-3 | Molecular Weight | 279.25000 | |
| Density | 1.49g/cm3 | Boiling Point | 436.3ºC at 760 mmHg | |
| Molecular Formula | C15H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | 3-naphthalen-1-yl-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 436.3ºC at 760 mmHg |
| Molecular Formula | C15H9N3O3 |
| Molecular Weight | 279.25000 |
| Flash Point | 217.6ºC |
| Exact Mass | 279.06400 |
| PSA | 69.51000 |
| LogP | 1.59160 |
| Index of Refraction | 1.739 |
| InChIKey | WVFLWCBWFAAFPW-UHFFFAOYSA-N |
| SMILES | O=c1nc2occn2c(=O)n1-c1cccc2ccccc12 |
|
~%
3-naphthalen-1-... CAS#:35629-65-3 |
| Literature: Crank; Foulis Journal of medicinal chemistry, 1971 , vol. 14, # 11 p. 1075 - 1077 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |