3-(4-chlorophenyl)-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione structure
|
Common Name | 3-(4-chlorophenyl)-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 35629-63-1 | Molecular Weight | 263.63700 | |
| Density | 1.63g/cm3 | Boiling Point | 384.1ºC at 760 mmHg | |
| Molecular Formula | C11H6ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.1ºC | |
| Name | 3-(4-chlorophenyl)-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione |
|---|
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 384.1ºC at 760 mmHg |
| Molecular Formula | C11H6ClN3O3 |
| Molecular Weight | 263.63700 |
| Flash Point | 186.1ºC |
| Exact Mass | 263.01000 |
| PSA | 69.51000 |
| LogP | 1.09180 |
| Index of Refraction | 1.73 |
| InChIKey | ZANQJECHIGXUGE-UHFFFAOYSA-N |
| SMILES | O=c1nc2occn2c(=O)n1-c1ccc(Cl)cc1 |
|
~%
3-(4-chlorophen... CAS#:35629-63-1 |
| Literature: Crank; Foulis Journal of medicinal chemistry, 1971 , vol. 14, # 11 p. 1075 - 1077 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |