1-(4,5-Diphenyl-1,3-oxazol-2-yl)-3-phenylure
Modify Date: 2025-09-18 12:41:23
1-(4,5-Diphenyl-1,3-oxazol-2-yl)-3-phenylure structure
|
Common Name | 1-(4,5-Diphenyl-1,3-oxazol-2-yl)-3-phenylure | ||
|---|---|---|---|---|
| CAS Number | 35629-55-1 | Molecular Weight | 355.38900 | |
| Density | 1.285g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4,5-Diphenyl-1,3-oxazol-2-yl)-3-phenylure |
|---|
| Density | 1.285g/cm3 |
|---|---|
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.38900 |
| Exact Mass | 355.13200 |
| PSA | 70.65000 |
| LogP | 5.73920 |
| Index of Refraction | 1.681 |
| InChIKey | BQFQPJLHFJHZSK-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)Nc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
|
~%
1-(4,5-Diphenyl... CAS#:35629-55-1 |
| Literature: Crank; Foulis Journal of medicinal chemistry, 1971 , vol. 14, # 11 p. 1075 - 1077 |
