Phosphetane, 2,2,3,3-tetramethyl-1-phenyl-, 1-sulfide structure
|
Common Name | Phosphetane, 2,2,3,3-tetramethyl-1-phenyl-, 1-sulfide | ||
|---|---|---|---|---|
| CAS Number | 35623-51-9 | Molecular Weight | 238.32900 | |
| Density | 1.07g/cm3 | Boiling Point | 305.8ºC at 760 mmHg | |
| Molecular Formula | C13H19PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.7ºC | |
| Name | 2,2,3,3-tetramethyl-1-phenyl-1-sulfanylidene-1λ5-phosphetane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 305.8ºC at 760 mmHg |
| Molecular Formula | C13H19PS |
| Molecular Weight | 238.32900 |
| Flash Point | 138.7ºC |
| Exact Mass | 238.09500 |
| PSA | 41.90000 |
| LogP | 4.26040 |
| Index of Refraction | 1.553 |
| InChIKey | APZNNOOUIMFJGH-UHFFFAOYSA-N |
| SMILES | CC1(C)CP(=S)(c2ccccc2)C1(C)C |
|
~%
Phosphetane, 2,... CAS#:35623-51-9 |
| Literature: Gray,G.A.; Cremer,S.E. Journal of Organic Chemistry, 1972 , vol. 37, p. 3458 - 3469 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Phosphetane,2,3,3-tetramethyl-1-phenyl-,1-sulfide |
| 2,2,3,3-tetramethyl-1-phenyl-phosphetane 1-sulfide |
| 2,2,3,3-tetramethyl-1-phenyl-1-sulfanylidene-1 |