Phenazinium,3,7-bis(diethylamino)-5-phenyl-, chloride (1:1)
Modify Date: 2025-08-25 23:54:31
Phenazinium,3,7-bis(diethylamino)-5-phenyl-, chloride (1:1) structure
|
Common Name | Phenazinium,3,7-bis(diethylamino)-5-phenyl-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 3562-38-7 | Molecular Weight | 435.00400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H31ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-N,2-N,8-N,8-N-tetraethyl-10-phenylphenazin-10-ium-2,8-diamine,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H31ClN4 |
|---|---|
| Molecular Weight | 435.00400 |
| Exact Mass | 434.22400 |
| PSA | 23.25000 |
| LogP | 2.36110 |
| Index of Refraction | 1.597 |
| InChIKey | OVYHWGDANKJLIW-UHFFFAOYSA-M |
| SMILES | CCN(CC)c1ccc2nc3ccc(N(CC)CC)cc3[n+](-c3ccccc3)c2c1.[Cl-] |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-Bis-diaethylamino-5-phenyl-phenazinium,Chlorid |
| AC1L3VB6 |
| 3,7-bis-diethylamino-5-phenyl-phenazinium,chloride |
| Heliotrope B |
| Heliotrope B (VAN) |
| Amethystviolett,Irisviolett |
| 3,7-Bis(dimethylamino)-5-phenylphenazinium chloride |
| Amethyst Violet |
| Amethyst violett |
| Heliotrope 2B |