1,3,3-tris(benzenesulfonyl)propylsulfonylbenzene structure
|
Common Name | 1,3,3-tris(benzenesulfonyl)propylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 3561-68-0 | Molecular Weight | 604.73500 | |
| Density | 1.427g/cm3 | Boiling Point | 916ºC at 760 mmHg | |
| Molecular Formula | C27H24O8S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 600.3ºC | |
| Name | 1,3,3-tris(benzenesulfonyl)propylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 916ºC at 760 mmHg |
| Molecular Formula | C27H24O8S4 |
| Molecular Weight | 604.73500 |
| Flash Point | 600.3ºC |
| Exact Mass | 604.03500 |
| PSA | 170.08000 |
| LogP | 8.24750 |
| Index of Refraction | 1.626 |
| InChIKey | QUBYTVNIITXXNX-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| HS Code | 2904100000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,3,3-Tetraphenylsulfon-propan |
| 1,1,3,3-Tetrakis-phenylsulfonyl-propan |
| 1,1,3,3-tetrakisphenylsulfonylpropane |