2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid
Modify Date: 2025-08-25 13:31:21
2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid structure
|
Common Name | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 356-33-2 | Molecular Weight | 204.07600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4F4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid |
|---|
| Molecular Formula | C5H4F4O4 |
|---|---|
| Molecular Weight | 204.07600 |
| Exact Mass | 204.00500 |
| PSA | 63.60000 |
| LogP | 0.51460 |
| InChIKey | JQYHTWJFTRVWFC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(=O)O |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:356-36-5
CAS#:1893-38-5
CAS#:755-73-7| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |