2-(4-fluorophenyl)-N-[(3-nitrophenyl)methyl]ethanamine structure
|
Common Name | 2-(4-fluorophenyl)-N-[(3-nitrophenyl)methyl]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 355816-83-0 | Molecular Weight | 274.29000 | |
| Density | 1.222g/cm3 | Boiling Point | 415.8ºC at 760 mmHg | |
| Molecular Formula | C15H15FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | 2-(4-fluorophenyl)-N-[(3-nitrophenyl)methyl]ethanamine |
|---|
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 415.8ºC at 760 mmHg |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.29000 |
| Flash Point | 205.3ºC |
| Exact Mass | 274.11200 |
| PSA | 57.85000 |
| LogP | 3.98030 |
| Index of Refraction | 1.583 |
| InChIKey | RGOBPOMSYBEPJQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CNCCc2ccc(F)cc2)c1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |