N-(1,3-benzodioxol-5-ylmethyl)-1-(3-bromophenyl)methanamine
Modify Date: 2024-11-12 15:02:04
N-(1,3-benzodioxol-5-ylmethyl)-1-(3-bromophenyl)methanamine structure
|
Common Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(3-bromophenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 355814-90-3 | Molecular Weight | 320.18100 | |
| Density | 1.461g/cm3 | Boiling Point | 417.8ºC at 760 mmHg | |
| Molecular Formula | C15H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.5ºC | |
| Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(3-bromophenyl)methanamine |
|---|
| Density | 1.461g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760 mmHg |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.18100 |
| Flash Point | 206.5ºC |
| Exact Mass | 319.02100 |
| PSA | 30.49000 |
| LogP | 3.85850 |
| Index of Refraction | 1.627 |
| InChIKey | YOTNHLVWMFBIMD-UHFFFAOYSA-N |
| SMILES | Brc1cccc(CNCc2ccc3c(c2)OCO3)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |