Ethanediamide, N,N'-bis(phenylmethyl)- structure
|
Common Name | Ethanediamide, N,N'-bis(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 3551-78-8 | Molecular Weight | 268.31000 | |
| Density | 1.177g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-dibenzyloxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.31000 |
| Exact Mass | 268.12100 |
| PSA | 58.20000 |
| LogP | 2.40100 |
| Index of Refraction | 1.589 |
| InChIKey | AOIKOYRULAZZLJ-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccc1)C(=O)NCc1ccccc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-dibenzyl-oxalamide |
| N,N'-dibenzylethanediamide |
| benzyloxalamide |
| N,N-dibenzyloxamide |
| N,N'-Dibenzyloxamid |