1H,1H-Undecafluorohexylamine
Modify Date: 2025-08-25 13:14:17
1H,1H-Undecafluorohexylamine structure
|
Common Name | 1H,1H-Undecafluorohexylamine | ||
|---|---|---|---|---|
| CAS Number | 355-34-0 | Molecular Weight | 299.08500 | |
| Density | 1.562g/cm3 | Boiling Point | 112ºC at 760 mmHg | |
| Molecular Formula | C6H4F11N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33.5ºC | |
| Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.562g/cm3 |
|---|---|
| Boiling Point | 112ºC at 760 mmHg |
| Molecular Formula | C6H4F11N |
| Molecular Weight | 299.08500 |
| Flash Point | 33.5ºC |
| Exact Mass | 299.01700 |
| PSA | 26.02000 |
| LogP | 3.74890 |
| Index of Refraction | 1.292 |
| InChIKey | FDIHRNYGDZQEAV-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2921199090 |
|---|
|
~%
1H,1H-Undecaflu... CAS#:355-34-0 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2691043 , 1956 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,2,3,3,4,4,5,5,6,6,6-Undecafluorohexylamine |
| 1H,1H-Undecafluorohexylamine |
| U0083 |
| 1H,1H-Perfluorohexylamine |
| PC6703 |
| 1-Amino-1H,1H-undecafluor-hexan |
| 2,2,3,3,4,4,5,5,6,6,6-Undecafluor-hexylamin |