potassium,2,4,5-trichlorophenolate structure
|
Common Name | potassium,2,4,5-trichlorophenolate | ||
|---|---|---|---|---|
| CAS Number | 35471-43-3 | Molecular Weight | 235.53700 | |
| Density | N/A | Boiling Point | 254.8ºC at 760 mmHg | |
| Molecular Formula | C6H2Cl3KO | Melting Point | 69ºC | |
| MSDS | N/A | Flash Point | 107.9ºC | |
| Name | potassium,2,4,5-trichlorophenolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 254.8ºC at 760 mmHg |
|---|---|
| Melting Point | 69ºC |
| Molecular Formula | C6H2Cl3KO |
| Molecular Weight | 235.53700 |
| Flash Point | 107.9ºC |
| Exact Mass | 233.88100 |
| PSA | 23.06000 |
| LogP | 3.79060 |
| InChIKey | NBMMDJIFROGEQN-UHFFFAOYSA-M |
| SMILES | [K+].[O-]c1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2908199090 |
|---|
|
~%
potassium,2,4,5... CAS#:35471-43-3 |
| Literature: Ba-Saif, Salem A.; Maude, Antony B.; Williams, Andrew Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 12 p. 2395 - 2400 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| potassium salt of 2,4,5-trichlorophenol |
| Potassium 2,4,5-trichlorophenolate |
| EINECS 252-584-3 |
| Caswell No. 704 |
| Potassium 2,4,5-trichlorophenate |