dimethyl L-2-(1,3-dioxo-2,3-dihydro-1H-2-isoindolyl)pentanedioate
Modify Date: 2025-09-14 22:19:42
dimethyl L-2-(1,3-dioxo-2,3-dihydro-1H-2-isoindolyl)pentanedioate structure
|
Common Name | dimethyl L-2-(1,3-dioxo-2,3-dihydro-1H-2-isoindolyl)pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 35457-98-8 | Molecular Weight | 305.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl L-2-(1,3-dioxo-2,3-dihydro-1H-2-isoindolyl)pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15NO6 |
|---|---|
| Molecular Weight | 305.28300 |
| Exact Mass | 305.09000 |
| PSA | 89.98000 |
| LogP | 0.71530 |
| InChIKey | AGWBTFOIAUGNNH-NSHDSACASA-N |
| SMILES | COC(=O)CCC(C(=O)OC)N1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2614-06-4| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| dimethyl 2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)pentanedioate |
| Dimethyl ester of N-phthalyl-L-glutamic acid |
| N-Phthaloylglutaminsaeuredimethylester |