4,6,7-trichloro-2-(pyrimidin-2-ylamino)-2,3-dihydro-1-benzofuran-5-ol structure
|
Common Name | 4,6,7-trichloro-2-(pyrimidin-2-ylamino)-2,3-dihydro-1-benzofuran-5-ol | ||
|---|---|---|---|---|
| CAS Number | 354552-50-4 | Molecular Weight | 332.57000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6,7-trichloro-2-(pyrimidin-2-ylamino)-2,3-dihydro-1-benzofuran-5-ol |
|---|
| Molecular Formula | C12H8Cl3N3O2 |
|---|---|
| Molecular Weight | 332.57000 |
| Exact Mass | 330.96800 |
| PSA | 67.27000 |
| LogP | 3.58850 |
| InChIKey | HNIMAFWOIDLBIU-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)c(Cl)c2c(c1Cl)CC(Nc1ncccn1)O2 |
|
~84%
4,6,7-trichloro... CAS#:354552-50-4 |
| Literature: Karlivans; Valters Chemistry of Heterocyclic Compounds, 2003 , vol. 39, # 12 p. 1617 - 1622 |
|
~%
4,6,7-trichloro... CAS#:354552-50-4 |
| Literature: Karlivans; Valters Chemistry of Heterocyclic Compounds, 2003 , vol. 39, # 12 p. 1617 - 1622 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |