2-(3-chloro-4-hydroxybenzoyl)benzoic acid structure
|
Common Name | 2-(3-chloro-4-hydroxybenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35414-46-1 | Molecular Weight | 276.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-chloro-4-hydroxybenzoyl)benzoic acid |
|---|
| Molecular Formula | C14H9ClO4 |
|---|---|
| Molecular Weight | 276.67200 |
| Exact Mass | 276.01900 |
| PSA | 74.60000 |
| LogP | 2.97480 |
| InChIKey | FPJUDNXOKUYQNQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(O)c(Cl)c1 |
| HS Code | 2918990090 |
|---|
|
~%
2-(3-chloro-4-h... CAS#:35414-46-1 |
| Literature: Gronowska,J.; Ruminski,J. Roczniki Chemii, 1971 , vol. 45, p. 1957 - 1966 |
|
~%
2-(3-chloro-4-h... CAS#:35414-46-1 |
| Literature: Hayashi Journal fuer Praktische Chemie (Leipzig), 1929 , vol. <2> 123, p. 295 |
|
~%
2-(3-chloro-4-h... CAS#:35414-46-1 |
| Literature: Thiel; Diehl Sitzungsberichte der Gesellschaft zur Befoerderung der Gesamten Naturwissenschaften zu Marburg, vol. 62, p. 538 Chem. Zentralbl., 1927 , vol. 98, # II p. 2671 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |