4-chloro-2-[2,2-dichloro-1-(5-chloro-2-methoxyphenyl)ethenyl]-1-methoxybenzene
Modify Date: 2025-09-19 09:51:12
![4-chloro-2-[2,2-dichloro-1-(5-chloro-2-methoxyphenyl)ethenyl]-1-methoxybenzene Structure](https://image.chemsrc.com/caspic/296/35374-20-0.png)
4-chloro-2-[2,2-dichloro-1-(5-chloro-2-methoxyphenyl)ethenyl]-1-methoxybenzene structure
|
Common Name | 4-chloro-2-[2,2-dichloro-1-(5-chloro-2-methoxyphenyl)ethenyl]-1-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 35374-20-0 | Molecular Weight | 378.07700 | |
| Density | 1.375g/cm3 | Boiling Point | 451.5ºC at 760 mmHg | |
| Molecular Formula | C16H12Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.4ºC | |
| Name | 4-chloro-2-[2,2-dichloro-1-(5-chloro-2-methoxyphenyl)ethenyl]-1-methoxybenzene |
|---|
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 451.5ºC at 760 mmHg |
| Molecular Formula | C16H12Cl4O2 |
| Molecular Weight | 378.07700 |
| Flash Point | 153.4ºC |
| Exact Mass | 375.95900 |
| PSA | 18.46000 |
| LogP | 6.20510 |
| Index of Refraction | 1.593 |
| InChIKey | OCTBWPUVCRTUQQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1C(=C(Cl)Cl)c1cc(Cl)ccc1OC |
|
~%
4-chloro-2-[2,2... CAS#:35374-20-0 |
| Literature: Liu,H.J. et al. Canadian Journal of Chemistry, 1972 , vol. 50, p. 55 - 60 |
|
~%
4-chloro-2-[2,2... CAS#:35374-20-0 |
| Literature: Conradi,R.A. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, p. 1000 - 1002 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |