5-methyl-[1,2,4]triazolo[4,3-a]quinoline-1-thiol structure
|
Common Name | 5-methyl-[1,2,4]triazolo[4,3-a]quinoline-1-thiol | ||
|---|---|---|---|---|
| CAS Number | 35359-27-4 | Molecular Weight | 215.27400 | |
| Density | 1.41 g/cm3 | Boiling Point | 318.6ºC at 760 mmHg | |
| Molecular Formula | C11H9N3S | Melting Point | >250℃ | |
| MSDS | N/A | Flash Point | 146.5ºC | |
| Name | 5-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41 g/cm3 |
|---|---|
| Boiling Point | 318.6ºC at 760 mmHg |
| Melting Point | >250℃ |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.27400 |
| Flash Point | 146.5ºC |
| Exact Mass | 215.05200 |
| PSA | 68.99000 |
| LogP | 2.47960 |
| Index of Refraction | 1.762 |
| InChIKey | VSUPYSJUZGXREB-UHFFFAOYSA-N |
| SMILES | Cc1cc2n[nH]c(=S)n2c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
5-methyl-[1,2,4... CAS#:35359-27-4 |
| Literature: US2861076 , ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| f1902-0023 |