benzyl (chlorocarbonyl)phenylacetate structure
|
Common Name | benzyl (chlorocarbonyl)phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 35353-13-0 | Molecular Weight | 288.72600 | |
| Density | 1.258g/cm3 | Boiling Point | 415.7ºC at 760mmHg | |
| Molecular Formula | C16H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.8ºC | |
| Name | benzyl 3-chloro-3-oxo-2-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 415.7ºC at 760mmHg |
| Molecular Formula | C16H13ClO3 |
| Molecular Weight | 288.72600 |
| Flash Point | 163.8ºC |
| Exact Mass | 288.05500 |
| PSA | 43.37000 |
| LogP | 3.27900 |
| Index of Refraction | 1.585 |
| InChIKey | VWOHADKFMSXEIE-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(C(=O)OCc1ccccc1)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~%
benzyl (chloroc... CAS#:35353-13-0 |
| Literature: Marchand-Brynaert, Jacqueline; Vanlierde, Huguette; Ghosez, Leon Bulletin des Societes Chimiques Belges, 1988 , vol. 97, # 11-12 p. 1081 - 1094 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzylphenylmalonsaeurechlorid |
| benzyl-2-chlorocarbonyl-2-phenylacetate |
| 2-benzyloxycarbonyl-phenylacetyl chloride |
| EINECS 252-523-0 |