benzoic acid,ethane-1,2-diamine
Modify Date: 2025-09-18 23:19:44
benzoic acid,ethane-1,2-diamine structure
|
Common Name | benzoic acid,ethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 35349-75-8 | Molecular Weight | 304.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzoic acid,ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H20N2O4 |
|---|---|
| Molecular Weight | 304.34100 |
| Exact Mass | 304.14200 |
| PSA | 126.64000 |
| LogP | 3.07400 |
| InChIKey | RYAQSTUAVRXDSV-UHFFFAOYSA-N |
| SMILES | NCCN.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoesaeure,Verbindung mit Aethylendiamin |
| 1,2-Ethanediamine,dibenzoate |
| benzoic acid,compound with ethylenediamine |