dimethyl 3,4-diaminonaphthalene-1,8-dicarboxylate
Modify Date: 2025-08-30 08:04:13
dimethyl 3,4-diaminonaphthalene-1,8-dicarboxylate structure
|
Common Name | dimethyl 3,4-diaminonaphthalene-1,8-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 35341-45-8 | Molecular Weight | 274.27200 | |
| Density | 1.345g/cm3 | Boiling Point | 523.1ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.3ºC | |
| Name | dimethyl 3,4-diaminonaphthalene-1,8-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 523.1ºC at 760 mmHg |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.27200 |
| Flash Point | 275.3ºC |
| Exact Mass | 274.09500 |
| PSA | 104.64000 |
| LogP | 2.73980 |
| Index of Refraction | 1.669 |
| InChIKey | AIIMYONIXNTBKV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc2c(N)c(N)cc(C(=O)OC)c12 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3.4-Diaminonaphthalin-1.8-dicarbonester |