(E)-ETHYL 4-(4-BROMOPHENYL)-4-OXOBUT-2-ENOATE structure
|
Common Name | (E)-ETHYL 4-(4-BROMOPHENYL)-4-OXOBUT-2-ENOATE | ||
|---|---|---|---|---|
| CAS Number | 35338-15-9 | Molecular Weight | 283.11800 | |
| Density | 1.413g/cm3 | Boiling Point | 362.5ºC at 760 mmHg | |
| Molecular Formula | C12H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | ethyl 4-(4-bromophenyl)-4-oxobut-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760 mmHg |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.11800 |
| Flash Point | 173ºC |
| Exact Mass | 281.98900 |
| PSA | 43.37000 |
| LogP | 2.75110 |
| Index of Refraction | 1.555 |
| InChIKey | ZLQHJDFXKLKCEE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC(=O)c1ccc(Br)cc1 |
| HS Code | 2918300090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 3-(4-bromobenzoyl)acrylate |
| ethyl (E)-4-(4-bromophenyl)-4-oxo-2-butenoate |
| (E)-ethyl 4-(4-bromophenyl)-4-oxo-but-2-enoate |
| (E)-ethyl 4-oxo-4-(4-bromophenyl)but-2-enoate |