4-(oxiranylmethoxy)-1H-indole
Modify Date: 2025-08-20 16:51:58
4-(oxiranylmethoxy)-1H-indole structure
|
Common Name | 4-(oxiranylmethoxy)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 35308-87-3 | Molecular Weight | 189.21100 | |
| Density | 1.294g/cm3 | Boiling Point | 381.2ºC at 760mmHg | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.6ºC | |
| Name | 4-(oxiran-2-ylmethoxy)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 381.2ºC at 760mmHg |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21100 |
| Flash Point | 138.6ºC |
| Exact Mass | 189.07900 |
| PSA | 37.55000 |
| LogP | 1.94550 |
| Index of Refraction | 1.661 |
| InChIKey | CTWQPSSVUYPWOM-UHFFFAOYSA-N |
| SMILES | c1cc(OCC2CO2)c2cc[nH]c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| glycidyl 4-Indolyl Ether |
| EINECS 252-506-8 |