trimethyl(8-trimethylsilylocta-2,6-dienyl)silane structure
|
Common Name | trimethyl(8-trimethylsilylocta-2,6-dienyl)silane | ||
|---|---|---|---|---|
| CAS Number | 3528-13-0 | Molecular Weight | 254.55900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H30Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(8-trimethylsilylocta-2,6-dienyl)silane |
|---|
| Molecular Formula | C14H30Si2 |
|---|---|
| Molecular Weight | 254.55900 |
| Exact Mass | 254.18900 |
| LogP | 5.55540 |
| InChIKey | UUPPIVRNYFRPLG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CC=CCCC=CC[Si](C)(C)C |
|
~43%
trimethyl(8-tri... CAS#:3528-13-0 |
| Literature: Ibrahim-Ouali, Malika Tetrahedron Letters, 2009 , vol. 50, # 14 p. 1607 - 1609 |
|
~%
trimethyl(8-tri... CAS#:3528-13-0 |
| Literature: Pellissier, Helene; Santelli, Maurice Journal of the Chemical Society, Chemical Communications, 1994 , # 7 p. 827 - 828 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |