5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one structure
|
Common Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 35274-39-6 | Molecular Weight | 366.25300 | |
| Density | 1.75g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H8BrNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.75g/cm3 |
|---|---|
| Molecular Formula | C14H8BrNO2S2 |
| Molecular Weight | 366.25300 |
| Exact Mass | 364.91800 |
| PSA | 99.63000 |
| LogP | 4.52670 |
| Index of Refraction | 1.768 |
| InChIKey | MERSOXJRJWZSND-UHFFFAOYSA-N |
| SMILES | O=C1NC(=S)SC1=Cc1ccc(-c2ccc(Br)cc2)o1 |
|
~%
5-[[5-(4-bromop... CAS#:35274-39-6 |
| Literature: Yaremenko,F.G. et al. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1977 , vol. 13, p. 1190 - 1194 Khimiya Geterotsiklicheskikh Soedinenii, 1977 , vol. 13, # 11 p. 1490 - 1494 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |