4-(trifluoromethyl)umbelliferyl oleate structure
|
Common Name | 4-(trifluoromethyl)umbelliferyl oleate | ||
|---|---|---|---|---|
| CAS Number | 352525-07-6 | Molecular Weight | 494.58600 | |
| Density | 1.115g/cm3 | Boiling Point | 546.8ºC at 760 mmHg | |
| Molecular Formula | C28H37F3O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 274ºC | |
| Name | 4-(trifluoromethyl)umbelliferyl oleate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 546.8ºC at 760 mmHg |
| Molecular Formula | C28H37F3O4 |
| Molecular Weight | 494.58600 |
| Flash Point | 274ºC |
| Exact Mass | 494.26400 |
| PSA | 56.51000 |
| LogP | 8.75470 |
| Index of Refraction | 1.498 |
| InChIKey | SUYMAHKATXKUBJ-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Oc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| TFMU-OLEATE |
| 4-Trifluoromethylumbelliferyl oleate |