[[4-[(carbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea
Modify Date: 2025-09-11 19:19:29
![[[4-[(carbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea Structure](https://image.chemsrc.com/caspic/308/3525-74-4.png)
[[4-[(carbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea structure
|
Common Name | [[4-[(carbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea | ||
|---|---|---|---|---|
| CAS Number | 3525-74-4 | Molecular Weight | 280.37200 | |
| Density | 1.43g/cm3 | Boiling Point | 478.6ºC at 760 mmHg | |
| Molecular Formula | C10H12N6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.3ºC | |
| Name | [(E)-[4-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 478.6ºC at 760 mmHg |
| Molecular Formula | C10H12N6S2 |
| Molecular Weight | 280.37200 |
| Flash Point | 243.3ºC |
| Exact Mass | 280.05600 |
| PSA | 165.00000 |
| LogP | 2.20320 |
| Index of Refraction | 1.717 |
| InChIKey | VTZWNSAFVYMODF-UHFFFAOYSA-N |
| SMILES | NC(=S)NN=Cc1ccc(C=NNC(N)=S)cc1 |
|
~93%
[[4-[(carbamoth... CAS#:3525-74-4 |
| Literature: Reddy, Desireddy Harikishore Kumar; Lee, Seung-Mok; Seshaiah, Kalluru; Babu, K. Ramesh Journal of the Serbian Chemical Society, 2013 , vol. 78, # 2 p. 229 - 240 |
|
~%
[[4-[(carbamoth... CAS#:3525-74-4 |
| Literature: Li, Peiyuan; Su, Wei; Liu, Lifeng; Chen, Rui; Huo, Lini Asian Journal of Chemistry, 2013 , vol. 25, # 4 p. 2319 - 2320 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-({4-[N-(carboxymethyl)carbamoyl]phenyl}carbonylamino)acetic acid |
| terepthaladehyde bis(thiosemicarbazone) |
| 1,4-Bis-thiosemicarbazonomethyl-benzol |
| terephthaldehyde bis(thiosemicarbazone) |
| N,N'-Terephthaloyl-bis-glycin |
| terephthaloylbisglycine |
| Terephthalaldehyd-Dithiosemicarbazon |
| Terephthalyldiglycin |
| terephthalamido-N,N-bis(acetic acid) |
| terephthalaldehyde-bis-(thiosemicarbazone) |
| [(4-{[(carboxymethyl)amino]carbonyl}benzoyl)amino]acetic acid |
| 2,2'-[1,4-phenylenebis(carbonylimino)]diacetic acid(non-preferred name) |
| Terephthalic-bis-thiosemicarbazon |
| N,N'-terephthaloyl-bis-glycine |
| Terephthalyl-bis-aminoessigsaeure |
| 2,2'-[1,4-bis(benzamido)]diacetic acid |
| benzene-1,4-dicarbaldehyde bis-thiosemicarbazone |