Ethanone, 2,2,2-trifluoro-1-(3-hydroxy-4-methylphenyl)- (9CI)
Modify Date: 2025-09-19 14:35:14
Ethanone, 2,2,2-trifluoro-1-(3-hydroxy-4-methylphenyl)- (9CI) structure
|
Common Name | Ethanone, 2,2,2-trifluoro-1-(3-hydroxy-4-methylphenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 352339-65-2 | Molecular Weight | 204.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-1-(3-hydroxy-4-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3O2 |
|---|---|
| Molecular Weight | 204.14600 |
| Exact Mass | 204.04000 |
| PSA | 37.30000 |
| LogP | 2.44560 |
| InChIKey | YUIHLCYGFMRMPL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(F)(F)F)cc1O |
| HS Code | 2914700090 |
|---|
|
~95%
Ethanone, 2,2,2... CAS#:352339-65-2 |
| Literature: Jacquot, Roland Patent: US2003/144541 A1, 2003 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-trifluoroacetyl-2-hydroxytoluene |