4,4',6,6'-tetranitro-2,2'-azoxytoluene structure
|
Common Name | 4,4',6,6'-tetranitro-2,2'-azoxytoluene | ||
|---|---|---|---|---|
| CAS Number | 35212-01-2 | Molecular Weight | 406.26400 | |
| Density | 1.74g/cm3 | Boiling Point | 627.3ºC at 760mmHg | |
| Molecular Formula | C14H10N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.2ºC | |
| Name | (2-methyl-3,5-dinitrophenyl)-(2-methyl-3,5-dinitrophenyl)imino-oxidoazanium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 627.3ºC at 760mmHg |
| Molecular Formula | C14H10N6O9 |
| Molecular Weight | 406.26400 |
| Flash Point | 333.2ºC |
| Exact Mass | 406.05100 |
| PSA | 224.39000 |
| LogP | 6.47790 |
| Index of Refraction | 1.719 |
| InChIKey | CSQSPVBKKCHHDS-UHFFFAOYSA-N |
| SMILES | Cc1c(N=[N+]([O-])c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2C)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2927000090 |
|---|
|
~92%
4,4',6,6'-tetra... CAS#:35212-01-2 |
| Literature: Wang, Chuanyue; Lyon, Delina Y.; Hughes, Joseph B.; Bennett, George N. Environmental Science and Technology, 2003 , vol. 37, # 16 p. 3595 - 3600 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4',6,6'-tetranitro-2,2'-azoxytoluene |
| 1,2-Bis(2-methyl-3,5-dinitrophenyl)diazene 1-oxide |
| 4,4',6,6'-Tetranitro-2,2'-azoxytoluol |
| 2,2'-azoxy-4,4',6,6'-tetranitrotoluene |