4,11-Diamino-2-octyl-1H-naphth[2,3-f]isoindole-1,3,5,10(2H)-tetrone structure
|
Common Name | 4,11-Diamino-2-octyl-1H-naphth[2,3-f]isoindole-1,3,5,10(2H)-tetrone | ||
|---|---|---|---|---|
| CAS Number | 35170-70-8 | Molecular Weight | 419.47300 | |
| Density | 1.338g/cm3 | Boiling Point | 682ºC at 760 mmHg | |
| Molecular Formula | C24H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 366.2ºC | |
| Name | 4,11-diamino-2-octylnaphtho[2,3-f]isoindole-1,3,5,10-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 682ºC at 760 mmHg |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.47300 |
| Flash Point | 366.2ºC |
| Exact Mass | 419.18500 |
| PSA | 125.25000 |
| LogP | 3.95140 |
| Index of Refraction | 1.659 |
| InChIKey | PIMCCBPBDJBTCL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCn1c(=O)c2c(N)c3c(=O)c4ccccc4c(=O)c3c(N)c2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Anthracenedicarboximide,1,4-diamino-9,10-dihydro-N-octyl-9,10-dioxo |