5-methoxy-3-(piperidin-4-ylmethyl)-1H-indole
Modify Date: 2025-08-26 12:14:10
5-methoxy-3-(piperidin-4-ylmethyl)-1H-indole structure
|
Common Name | 5-methoxy-3-(piperidin-4-ylmethyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 3515-52-4 | Molecular Weight | 244.33200 | |
| Density | 1.124g/cm3 | Boiling Point | 436.1ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | 5-methoxy-3-(piperidin-4-ylmethyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 436.1ºC at 760 mmHg |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.33200 |
| Flash Point | 217.6ºC |
| Exact Mass | 244.15800 |
| PSA | 37.05000 |
| LogP | 3.04740 |
| Index of Refraction | 1.602 |
| InChIKey | URURNXZHHMVWSK-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]cc(CC3CCNCC3)c2c1 |
| HS Code | 2933990090 |
|---|
|
~38%
5-methoxy-3-(pi... CAS#:3515-52-4 |
| Literature: Gueremy, Claude; Audiau, Francois; Champseix, Alain; Uzan, Andre; Fur, Gerard Le; Rataud, Jean Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1306 - 1310 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methoxy-3-piperidin-4-ylmethyl-indole |
| 5-Methoxy-3-<4>piperidylmethyl-indol |