3-hydroxy-2-phenyl-[1,3]thiazolo[3,2-a]pyridin-4-ium-8-olate
Modify Date: 2025-08-24 21:32:05
![3-hydroxy-2-phenyl-[1,3]thiazolo[3,2-a]pyridin-4-ium-8-olate Structure](https://image.chemsrc.com/caspic/132/35143-57-8.png)
3-hydroxy-2-phenyl-[1,3]thiazolo[3,2-a]pyridin-4-ium-8-olate structure
|
Common Name | 3-hydroxy-2-phenyl-[1,3]thiazolo[3,2-a]pyridin-4-ium-8-olate | ||
|---|---|---|---|---|
| CAS Number | 35143-57-8 | Molecular Weight | 243.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-2-phenyl-[1,3]thiazolo[3,2-a]pyridin-4-ium-8-olate |
|---|
| Molecular Formula | C13H9NO2S |
|---|---|
| Molecular Weight | 243.28100 |
| Exact Mass | 243.03500 |
| PSA | 75.63000 |
| LogP | 3.00320 |
| InChIKey | LATUNNOOSZTYQB-UHFFFAOYSA-N |
| SMILES | [O-]c1ccc[n+]2c(O)c(-c3ccccc3)sc12 |
| HS Code | 2934100090 |
|---|
|
~%
3-hydroxy-2-phe... CAS#:35143-57-8 |
| Literature: Walker, Keith A. M.; Sjogren, Eric B.; Matthews, Thomas R. Journal of Medicinal Chemistry, 1985 , vol. 28, # 11 p. 1673 - 1679 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![8-acetyloxy-2-phenyl-[1,3]thiazolo[3,2-a]pyridin-4-ium-3-olate structure](https://image.chemsrc.com/caspic/171/32002-92-9.png)
CAS#:32002-92-9| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |