methyl 2,3-dichloro-3-phenyl-propanoate
Modify Date: 2025-09-16 10:33:34
methyl 2,3-dichloro-3-phenyl-propanoate structure
|
Common Name | methyl 2,3-dichloro-3-phenyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 35115-84-5 | Molecular Weight | 233.09100 | |
| Density | 1.276g/cm3 | Boiling Point | 301.9ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.8ºC | |
| Name | methyl 2,3-dichloro-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 301.9ºC at 760 mmHg |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09100 |
| Flash Point | 122.8ºC |
| Exact Mass | 232.00600 |
| PSA | 26.30000 |
| LogP | 2.74690 |
| Index of Refraction | 1.53 |
| InChIKey | YOWWUZLQXXBDBP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cl)C(Cl)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:705-54-4| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3-Dichlor-3-phenyl-propionsaeure-methylester |
| METHYL 2,3-DICHLORO-3-PHENYL-PROPANOATE |
| 2,3-dichloro-3-phenyl-propionic acid methyl ester |