2-hexyl-1-nitroguanidine structure
|
Common Name | 2-hexyl-1-nitroguanidine | ||
|---|---|---|---|---|
| CAS Number | 35089-71-5 | Molecular Weight | 188.22800 | |
| Density | 1.2g/cm3 | Boiling Point | 312.2ºC at 760 mmHg | |
| Molecular Formula | C7H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6ºC | |
| Name | 2-hexyl-1-nitroguanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 312.2ºC at 760 mmHg |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.22800 |
| Flash Point | 142.6ºC |
| Exact Mass | 188.12700 |
| PSA | 93.73000 |
| LogP | 2.27710 |
| Index of Refraction | 1.531 |
| InChIKey | XVQKTZOOSZOPAM-UHFFFAOYSA-N |
| SMILES | CCCCCCN=C(N)N[N+](=O)[O-] |
| HS Code | 2925290090 |
|---|
|
~%
2-hexyl-1-nitro... CAS#:35089-71-5 |
| Literature: Iwahara; Yanagimachi; Kamiya; Nakadate; Suzuki Chemical and pharmaceutical bulletin, 1971 , vol. 19, # 9 p. 1914 - 1918 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Guanidine,n-hexyl-N'-nitro |
| n-Hexyl-N'-nitroguanidine |