1-nitro-2-(pyridin-3-ylmethyl)guanidine
Modify Date: 2025-09-19 18:33:11
1-nitro-2-(pyridin-3-ylmethyl)guanidine structure
|
Common Name | 1-nitro-2-(pyridin-3-ylmethyl)guanidine | ||
|---|---|---|---|---|
| CAS Number | 35089-65-7 | Molecular Weight | 195.17900 | |
| Density | 1.46g/cm3 | Boiling Point | 396.6ºC at 760 mmHg | |
| Molecular Formula | C7H9N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | 1-nitro-2-(pyridin-3-ylmethyl)guanidine |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 396.6ºC at 760 mmHg |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.17900 |
| Flash Point | 193.6ºC |
| Exact Mass | 195.07600 |
| PSA | 106.62000 |
| LogP | 1.29200 |
| Index of Refraction | 1.657 |
| InChIKey | ANEUOZZZHKXARU-UHFFFAOYSA-N |
| SMILES | NC(=NCc1cccnc1)N[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~%
1-nitro-2-(pyri... CAS#:35089-65-7 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US5034404 A1, 1991 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |