ethyl dehydrocyclogeranate structure
|
Common Name | ethyl dehydrocyclogeranate | ||
|---|---|---|---|---|
| CAS Number | 35044-57-6 | Molecular Weight | 194.27000 | |
| Density | 0.954 g/cm3 | Boiling Point | 240ºC at 760 mmHg | |
| Molecular Formula | C12H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.2ºC | |
| Name | ethyl safranate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.954 g/cm3 |
|---|---|
| Boiling Point | 240ºC at 760 mmHg |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27000 |
| Flash Point | 90.2ºC |
| Exact Mass | 194.13100 |
| PSA | 26.30000 |
| LogP | 2.85210 |
| Index of Refraction | 1.467 |
| InChIKey | ZANQMOGWQBCGBN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(C)=CC=CC1(C)C |
| HS Code | 2916209090 |
|---|
|
~%
ethyl dehydrocy... CAS#:35044-57-6 |
| Literature: Ligand Pharmaceuticals Incorporated Patent: US5514821 A1, 1996 ; |
|
~85%
ethyl dehydrocy... CAS#:35044-57-6 |
| Literature: Yadav; Srinivas, Dale Tetrahedron Letters, 1997 , vol. 38, # 44 p. 7789 - 7792 |
|
~46%
ethyl dehydrocy... CAS#:35044-57-6 |
| Literature: Bennani; Boehm Journal of Organic Chemistry, 1995 , vol. 60, # 5 p. 1195 - 1200 |
|
~%
ethyl dehydrocy... CAS#:35044-57-6 |
| Literature: Buechi,G.; Wuest,H. Helvetica Chimica Acta, 1971 , vol. 54, p. 1767 - 1775 |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| ethyl 2,6,6-trimethyl-2,4-cyclohexadiene-1-carboxylate |
| ethyl 2,6,6-trimethylcyclohexa-2,4-diene-1-carboxylate |
| 3-amino-3-phenyl-propionic acid ethyl ester hydrochloride |
| ethyl rac-3-amino-3-phenyl-propionate hydrochloride |
| 2,6,6-trimethyl-1-ethoxycarbonyl-2,4-cyclohexadiene |
| 2,6,6-trimethyl-2,4-cyclohexadiene-1-carboxylic acid ethyl ester |