bis(2-fluoro-2,2-dinitroethyl) hexanedioate
Modify Date: 2025-08-25 15:01:02
bis(2-fluoro-2,2-dinitroethyl) hexanedioate structure
|
Common Name | bis(2-fluoro-2,2-dinitroethyl) hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 35027-66-8 | Molecular Weight | 418.21900 | |
| Density | 1.592g/cm3 | Boiling Point | 388ºC at 760mmHg | |
| Molecular Formula | C10H12F2N4O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.5ºC | |
| Name | bis(2-fluoro-2,2-dinitroethyl) hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592g/cm3 |
|---|---|
| Boiling Point | 388ºC at 760mmHg |
| Molecular Formula | C10H12F2N4O12 |
| Molecular Weight | 418.21900 |
| Flash Point | 188.5ºC |
| Exact Mass | 418.04200 |
| PSA | 235.88000 |
| LogP | 2.07940 |
| Index of Refraction | 1.492 |
| InChIKey | KYXDFXJLIZHHHK-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)OCC(F)([N+](=O)[O-])[N+](=O)[O-])OCC(F)([N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2917120090 |
|---|
|
~%
bis(2-fluoro-2,... CAS#:35027-66-8 |
| Literature: Cochoy,R.E.; R McGuire,R. Journal of Organic Chemistry, 1972 , vol. 37, p. 3041 - 3042 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917120090 |
|---|---|
| Summary | 2917120090. adipic acid and its salts. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| einecs 252-322-8 |